C24H29N5O2 — CID 140621420
N-[4-(1-but-3-enoylpiperidin-4-yl)phenyl]-1-pyridazin-3-ylpyrrolidine-3-carboxamide (PubChem CID 140621420) has the molecular formula C24H29N5O2 and a molecular weight of 419.53 g/mol. Its IUPAC name is N-[4-(1-but-3-enoylpiperidin-4-yl)phenyl]-1-pyridazin-3-ylpyrrolidine-3-carboxamide.
| Compound Name | N-[4-(1-but-3-enoylpiperidin-4-yl)phenyl]-1-pyridazin-3-ylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 140621420 |
| Molecular Formula | C24H29N5O2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | N-[4-(1-but-3-enoylpiperidin-4-yl)phenyl]-1-pyridazin-3-ylpyrrolidine-3-carboxamide |
| SMILES | C=CCC(=O)N1CCC(c2ccc(NC(=O)C3CCN(c4cccnn4)C3)cc2)CC1 |
| InChI | InChI=1S/C24H29N5O2/c1-2-4-23(30)28-14-10-19(11-15-28)18-6-8-21(9-7-18)26-24(31)20-12-16-29(17-20)22-5-3-13-25-27-22/h2-3,5-9,13,19-20H,1,4,10-12,14-17H2,(H,26,31) |
| InChIKey | HQSIHQMWMBQMPD-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|