About 4-propan-2-yl-1,2,4-triazole-3-carboxamide
4-propan-2-yl-1,2,4-triazole-3-carboxamide (PubChem CID 140621561) has the molecular formula C6H10N4O
and a molecular weight of 154.17 g/mol. Its IUPAC name is 4-propan-2-yl-1,2,4-triazole-3-carboxamide.
Molecular Properties
| Compound Name | 4-propan-2-yl-1,2,4-triazole-3-carboxamide |
| PubChem CID | 140621561 |
| Molecular Formula | C6H10N4O |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.09 |
| IUPAC Name | 4-propan-2-yl-1,2,4-triazole-3-carboxamide |
| SMILES | CC(C)n1cnnc1C(N)=O |
| InChI | InChI=1S/C6H10N4O/c1-4(2)10-3-8-9-6(10)5(7)11/h3-4H,1-2H3,(H2,7,11) |
| InChIKey | TXMYYXLVEPLQJJ-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-propan-2-yl-1,2,4-triazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-yl-1,2,4-triazole-3-carboxamide?
The IUPAC name of 4-propan-2-yl-1,2,4-triazole-3-carboxamide (CID 140621561) is 4-propan-2-yl-1,2,4-triazole-3-carboxamide.
What is the SMILES notation for 4-propan-2-yl-1,2,4-triazole-3-carboxamide?
The canonical SMILES for 4-propan-2-yl-1,2,4-triazole-3-carboxamide is CC(C)n1cnnc1C(N)=O.
What is the InChIKey of 4-propan-2-yl-1,2,4-triazole-3-carboxamide?
The InChIKey is TXMYYXLVEPLQJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4O/c1-4(2)10-3-8-9-6(10)5(7)11/h3-4H,1-2H3,(H2,7,11).
What are the key properties of 4-propan-2-yl-1,2,4-triazole-3-carboxamide?
4-propan-2-yl-1,2,4-triazole-3-carboxamide has a molecular weight of 154.17 g/mol, XLogP of -0.04, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-yl-1,2,4-triazole-3-carboxamide is sourced from PubChem (CID 140621561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).