C20H17F3N2O2 — CID 140621679
5-[3-[4-(trifluoromethyl)phenyl]quinoxalin-2-yl]pentanoic acid (PubChem CID 140621679) has the molecular formula C20H17F3N2O2 and a molecular weight of 374.36 g/mol. Its IUPAC name is 5-[3-[4-(trifluoromethyl)phenyl]quinoxalin-2-yl]pentanoic acid.
| Compound Name | 5-[3-[4-(trifluoromethyl)phenyl]quinoxalin-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 140621679 |
| Molecular Formula | C20H17F3N2O2 |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 5-[3-[4-(trifluoromethyl)phenyl]quinoxalin-2-yl]pentanoic acid |
| SMILES | O=C(O)CCCCc1nc2ccccc2nc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H17F3N2O2/c21-20(22,23)14-11-9-13(10-12-14)19-17(7-3-4-8-18(26)27)24-15-5-1-2-6-16(15)25-19/h1-2,5-6,9-12H,3-4,7-8H2,(H,26,27) |
| InChIKey | JZQYAKLFRKSFDA-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|