C20H35N3O2S — CID 140622021
2-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yloxy)-N-(3-methylpyrazolidin-4-yl)-N-(thiolan-2-ylmethyl)acetamide (PubChem CID 140622021) has the molecular formula C20H35N3O2S and a molecular weight of 381.59 g/mol. Its IUPAC name is 2-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yloxy)-N-(3-methylpyrazolidin-4-yl)-N-(thiolan-2-ylmethyl)acetamide.
| Compound Name | 2-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yloxy)-N-(3-methylpyrazolidin-4-yl)-N-(thiolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 140622021 |
| Molecular Formula | C20H35N3O2S |
| Molecular Weight | 381.59 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | 2-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yloxy)-N-(3-methylpyrazolidin-4-yl)-N-(thiolan-2-ylmethyl)acetamide |
| SMILES | CC1NNCC1N(CC1CCCS1)C(=O)COC1CCC2CCCC2C1 |
| InChI | InChI=1S/C20H35N3O2S/c1-14-19(11-21-22-14)23(12-18-6-3-9-26-18)20(24)13-25-17-8-7-15-4-2-5-16(15)10-17/h14-19,21-22H,2-13H2,1H3 |
| InChIKey | MXFMTZCNWRXSAU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.59 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |