C27H24F3N3O5S2 — CID 140622934
2,5-difluoro-N-[2-fluoro-3-[2-(oxan-4-yl)-5-(1-oxidopyridin-1-ium-4-yl)-1,3-thiazol-4-yl]phenyl]-N-(methoxymethyl)benzenesulfonamide (PubChem CID 140622934) has the molecular formula C27H24F3N3O5S2 and a molecular weight of 591.63 g/mol. Its IUPAC name is 2,5-difluoro-N-[2-fluoro-3-[2-(oxan-4-yl)-5-(1-oxidopyridin-1-ium-4-yl)-1,3-thiazol-4-yl]phenyl]-N-(methoxymethyl)benzenesulfonamide.
| Compound Name | 2,5-difluoro-N-[2-fluoro-3-[2-(oxan-4-yl)-5-(1-oxidopyridin-1-ium-4-yl)-1,3-thiazol-4-yl]phenyl]-N-(methoxymethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 140622934 |
| Molecular Formula | C27H24F3N3O5S2 |
| Molecular Weight | 591.63 g/mol |
| Exact Mass | 591.11 |
| IUPAC Name | 2,5-difluoro-N-[2-fluoro-3-[2-(oxan-4-yl)-5-(1-oxidopyridin-1-ium-4-yl)-1,3-thiazol-4-yl]phenyl]-N-(methoxymethyl)benzenesulfonamide |
| SMILES | COCN(c1cccc(-c2nc(C3CCOCC3)sc2-c2cc[n+]([O-])cc2)c1F)S(=O)(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C27H24F3N3O5S2/c1-37-16-33(40(35,36)23-15-19(28)5-6-21(23)29)22-4-2-3-20(24(22)30)25-26(17-7-11-32(34)12-8-17)39-27(31-25)18-9-13-38-14-10-18/h2-8,11-12,15,18H,9-10,13-14,16H2,1H3 |
| InChIKey | BYTDSNKWIRBLIO-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 95.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.63 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|