C24H36ClF6N5O — CID 140623016
N-[(Z)-N-(2-chloro-4-fluorocyclohexyl)-N'-[5-(3,5-difluorocyclohexyl)pyrazolidin-3-yl]carbamimidoyl]-4-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 140623016) has the molecular formula C24H36ClF6N5O and a molecular weight of 560.03 g/mol. Its IUPAC name is N-[(Z)-N-(2-chloro-4-fluorocyclohexyl)-N'-[5-(3,5-difluorocyclohexyl)pyrazolidin-3-yl]carbamimidoyl]-4-(trifluoromethyl)cyclohexane-1-carboxamide.
| Compound Name | N-[(Z)-N-(2-chloro-4-fluorocyclohexyl)-N'-[5-(3,5-difluorocyclohexyl)pyrazolidin-3-yl]carbamimidoyl]-4-(trifluoromethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 140623016 |
| Molecular Formula | C24H36ClF6N5O |
| Molecular Weight | 560.03 g/mol |
| Exact Mass | 559.25 |
| IUPAC Name | N-[(Z)-N-(2-chloro-4-fluorocyclohexyl)-N'-[5-(3,5-difluorocyclohexyl)pyrazolidin-3-yl]carbamimidoyl]-4-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | O=C(N/C(=N\C1CC(C2CC(F)CC(F)C2)NN1)NC1CCC(F)CC1Cl)C1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C24H36ClF6N5O/c25-18-10-15(26)5-6-19(18)32-23(34-22(37)12-1-3-14(4-2-12)24(29,30)31)33-21-11-20(35-36-21)13-7-16(27)9-17(28)8-13/h12-21,35-36H,1-11H2,(H2,32,33,34,37) |
| InChIKey | WTFIEJMZOYASRL-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 77.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.03 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|