About 5,5-dimethyl-1,3,2-dioxaborinane-2-carbonitrile
5,5-dimethyl-1,3,2-dioxaborinane-2-carbonitrile (PubChem CID 140624236) has the molecular formula C6H10BNO2
and a molecular weight of 138.96 g/mol. Its IUPAC name is 5,5-dimethyl-1,3,2-dioxaborinane-2-carbonitrile.
Molecular Properties
| Compound Name | 5,5-dimethyl-1,3,2-dioxaborinane-2-carbonitrile |
| PubChem CID | 140624236 |
| Molecular Formula | C6H10BNO2 |
| Molecular Weight | 138.96 g/mol |
| Exact Mass | 139.08 |
| IUPAC Name | 5,5-dimethyl-1,3,2-dioxaborinane-2-carbonitrile |
| SMILES | CC1(C)COB(C#N)OC1 |
| InChI | InChI=1S/C6H10BNO2/c1-6(2)3-9-7(5-8)10-4-6/h3-4H2,1-2H3 |
| InChIKey | HLBWOWFUQWNRQJ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.96 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dimethyl-1,3,2-dioxaborinane-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyl-1,3,2-dioxaborinane-2-carbonitrile?
The IUPAC name of 5,5-dimethyl-1,3,2-dioxaborinane-2-carbonitrile (CID 140624236) is 5,5-dimethyl-1,3,2-dioxaborinane-2-carbonitrile.
What is the SMILES notation for 5,5-dimethyl-1,3,2-dioxaborinane-2-carbonitrile?
The canonical SMILES for 5,5-dimethyl-1,3,2-dioxaborinane-2-carbonitrile is CC1(C)COB(C#N)OC1.
What is the InChIKey of 5,5-dimethyl-1,3,2-dioxaborinane-2-carbonitrile?
The InChIKey is HLBWOWFUQWNRQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10BNO2/c1-6(2)3-9-7(5-8)10-4-6/h3-4H2,1-2H3.
What are the key properties of 5,5-dimethyl-1,3,2-dioxaborinane-2-carbonitrile?
5,5-dimethyl-1,3,2-dioxaborinane-2-carbonitrile has a molecular weight of 138.96 g/mol, XLogP of 0.61, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-1,3,2-dioxaborinane-2-carbonitrile is sourced from PubChem (CID 140624236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).