About N-trimethylsilyl-N-triphenylsilyl-1,2,4-oxadiazol-5-amine
N-trimethylsilyl-N-triphenylsilyl-1,2,4-oxadiazol-5-amine (PubChem CID 140624410) has the molecular formula C23H25N3OSi2
and a molecular weight of 415.65 g/mol. Its IUPAC name is N-trimethylsilyl-N-triphenylsilyl-1,2,4-oxadiazol-5-amine.
Molecular Properties
| Compound Name | N-trimethylsilyl-N-triphenylsilyl-1,2,4-oxadiazol-5-amine |
| PubChem CID | 140624410 |
| Molecular Formula | C23H25N3OSi2 |
| Molecular Weight | 415.65 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | N-trimethylsilyl-N-triphenylsilyl-1,2,4-oxadiazol-5-amine |
| SMILES | C[Si](C)(C)N(c1ncno1)[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H25N3OSi2/c1-28(2,3)26(23-24-19-25-27-23)29(20-13-7-4-8-14-20,21-15-9-5-10-16-21)22-17-11-6-12-18-22/h4-19H,1-3H3 |
| InChIKey | ZEBMVPOWNNEZAI-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.65 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze N-trimethylsilyl-N-triphenylsilyl-1,2,4-oxadiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-trimethylsilyl-N-triphenylsilyl-1,2,4-oxadiazol-5-amine?
The IUPAC name of N-trimethylsilyl-N-triphenylsilyl-1,2,4-oxadiazol-5-amine (CID 140624410) is N-trimethylsilyl-N-triphenylsilyl-1,2,4-oxadiazol-5-amine.
What is the SMILES notation for N-trimethylsilyl-N-triphenylsilyl-1,2,4-oxadiazol-5-amine?
The canonical SMILES for N-trimethylsilyl-N-triphenylsilyl-1,2,4-oxadiazol-5-amine is C[Si](C)(C)N(c1ncno1)[Si](c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of N-trimethylsilyl-N-triphenylsilyl-1,2,4-oxadiazol-5-amine?
The InChIKey is ZEBMVPOWNNEZAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25N3OSi2/c1-28(2,3)26(23-24-19-25-27-23)29(20-13-7-4-8-14-20,21-15-9-5-10-16-21)22-17-11-6-12-18-22/h4-19H,1-3H3.
What are the key properties of N-trimethylsilyl-N-triphenylsilyl-1,2,4-oxadiazol-5-amine?
N-trimethylsilyl-N-triphenylsilyl-1,2,4-oxadiazol-5-amine has a molecular weight of 415.65 g/mol, XLogP of 3.38, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-trimethylsilyl-N-triphenylsilyl-1,2,4-oxadiazol-5-amine is sourced from PubChem (CID 140624410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).