About N-ethyl-N-trimethylsilylpteridin-6-amine
N-ethyl-N-trimethylsilylpteridin-6-amine (PubChem CID 140624706) has the molecular formula C11H17N5Si
and a molecular weight of 247.38 g/mol. Its IUPAC name is N-ethyl-N-trimethylsilylpteridin-6-amine.
Molecular Properties
| Compound Name | N-ethyl-N-trimethylsilylpteridin-6-amine |
| PubChem CID | 140624706 |
| Molecular Formula | C11H17N5Si |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | N-ethyl-N-trimethylsilylpteridin-6-amine |
| SMILES | CCN(c1cnc2ncncc2n1)[Si](C)(C)C |
| InChI | InChI=1S/C11H17N5Si/c1-5-16(17(2,3)4)10-7-13-11-9(15-10)6-12-8-14-11/h6-8H,5H2,1-4H3 |
| InChIKey | NUWPTDXHNCGKGP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 54.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N-trimethylsilylpteridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-trimethylsilylpteridin-6-amine?
The IUPAC name of N-ethyl-N-trimethylsilylpteridin-6-amine (CID 140624706) is N-ethyl-N-trimethylsilylpteridin-6-amine.
What is the SMILES notation for N-ethyl-N-trimethylsilylpteridin-6-amine?
The canonical SMILES for N-ethyl-N-trimethylsilylpteridin-6-amine is CCN(c1cnc2ncncc2n1)[Si](C)(C)C.
What is the InChIKey of N-ethyl-N-trimethylsilylpteridin-6-amine?
The InChIKey is NUWPTDXHNCGKGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N5Si/c1-5-16(17(2,3)4)10-7-13-11-9(15-10)6-12-8-14-11/h6-8H,5H2,1-4H3.
What are the key properties of N-ethyl-N-trimethylsilylpteridin-6-amine?
N-ethyl-N-trimethylsilylpteridin-6-amine has a molecular weight of 247.38 g/mol, XLogP of 2.08, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-trimethylsilylpteridin-6-amine is sourced from PubChem (CID 140624706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).