About N-triethylsilyl-1-trimethylsilyl-N-triphenylsilylpyrazol-4-amine
N-triethylsilyl-1-trimethylsilyl-N-triphenylsilylpyrazol-4-amine (PubChem CID 140624852) has the molecular formula C30H41N3Si3
and a molecular weight of 527.94 g/mol. Its IUPAC name is N-triethylsilyl-1-trimethylsilyl-N-triphenylsilylpyrazol-4-amine.
Molecular Properties
| Compound Name | N-triethylsilyl-1-trimethylsilyl-N-triphenylsilylpyrazol-4-amine |
| PubChem CID | 140624852 |
| Molecular Formula | C30H41N3Si3 |
| Molecular Weight | 527.94 g/mol |
| Exact Mass | 527.26 |
| IUPAC Name | N-triethylsilyl-1-trimethylsilyl-N-triphenylsilylpyrazol-4-amine |
| SMILES | CC[Si](CC)(CC)N(c1cnn([Si](C)(C)C)c1)[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H41N3Si3/c1-7-35(8-2,9-3)33(27-25-31-32(26-27)34(4,5)6)36(28-19-13-10-14-20-28,29-21-15-11-16-22-29)30-23-17-12-18-24-30/h10-26H,7-9H2,1-6H3 |
| InChIKey | WXCHXYKLUVDWBN-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 527.94 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze N-triethylsilyl-1-trimethylsilyl-N-triphenylsilylpyrazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-triethylsilyl-1-trimethylsilyl-N-triphenylsilylpyrazol-4-amine?
The IUPAC name of N-triethylsilyl-1-trimethylsilyl-N-triphenylsilylpyrazol-4-amine (CID 140624852) is N-triethylsilyl-1-trimethylsilyl-N-triphenylsilylpyrazol-4-amine.
What is the SMILES notation for N-triethylsilyl-1-trimethylsilyl-N-triphenylsilylpyrazol-4-amine?
The canonical SMILES for N-triethylsilyl-1-trimethylsilyl-N-triphenylsilylpyrazol-4-amine is CC[Si](CC)(CC)N(c1cnn([Si](C)(C)C)c1)[Si](c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of N-triethylsilyl-1-trimethylsilyl-N-triphenylsilylpyrazol-4-amine?
The InChIKey is WXCHXYKLUVDWBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H41N3Si3/c1-7-35(8-2,9-3)33(27-25-31-32(26-27)34(4,5)6)36(28-19-13-10-14-20-28,29-21-15-11-16-22-29)30-23-17-12-18-24-30/h10-26H,7-9H2,1-6H3.
What are the key properties of N-triethylsilyl-1-trimethylsilyl-N-triphenylsilylpyrazol-4-amine?
N-triethylsilyl-1-trimethylsilyl-N-triphenylsilylpyrazol-4-amine has a molecular weight of 527.94 g/mol, XLogP of 6.04, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-triethylsilyl-1-trimethylsilyl-N-triphenylsilylpyrazol-4-amine is sourced from PubChem (CID 140624852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).