C13H28N2O2Si — CID 140625026
3-(4,5-dihydroimidazol-1-yl)propyl-methyl-dipropoxysilane (PubChem CID 140625026) has the molecular formula C13H28N2O2Si and a molecular weight of 272.46 g/mol. Its IUPAC name is 3-(4,5-dihydroimidazol-1-yl)propyl-methyl-dipropoxysilane.
| Compound Name | 3-(4,5-dihydroimidazol-1-yl)propyl-methyl-dipropoxysilane |
|---|---|
| PubChem CID | 140625026 |
| Molecular Formula | C13H28N2O2Si |
| Molecular Weight | 272.46 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 3-(4,5-dihydroimidazol-1-yl)propyl-methyl-dipropoxysilane |
| SMILES | CCCO[Si](C)(CCCN1C=NCC1)OCCC |
| InChI | InChI=1S/C13H28N2O2Si/c1-4-10-16-18(3,17-11-5-2)12-6-8-15-9-7-14-13-15/h13H,4-12H2,1-3H3 |
| InChIKey | MCNWHYBWYKFYFK-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.46 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|