C22H27ClFN3O6S2 — CID 140625497
2-[[3-[5-(4-carbamimidoyl-3-fluorophenoxy)carbonylthiophen-2-yl]-2,2-dimethylpropanoyl]-prop-2-enylamino]ethanesulfonic acid;hydrochloride (PubChem CID 140625497) has the molecular formula C22H27ClFN3O6S2 and a molecular weight of 548.06 g/mol. Its IUPAC name is 2-[[3-[5-(4-carbamimidoyl-3-fluorophenoxy)carbonylthiophen-2-yl]-2,2-dimethylpropanoyl]-prop-2-enylamino]ethanesulfonic acid;hydrochloride.
| Compound Name | 2-[[3-[5-(4-carbamimidoyl-3-fluorophenoxy)carbonylthiophen-2-yl]-2,2-dimethylpropanoyl]-prop-2-enylamino]ethanesulfonic acid;hydrochloride |
|---|---|
| PubChem CID | 140625497 |
| Molecular Formula | C22H27ClFN3O6S2 |
| Molecular Weight | 548.06 g/mol |
| Exact Mass | 547.10 |
| IUPAC Name | 2-[[3-[5-(4-carbamimidoyl-3-fluorophenoxy)carbonylthiophen-2-yl]-2,2-dimethylpropanoyl]-prop-2-enylamino]ethanesulfonic acid;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(OC(=O)c2ccc(CC(C)(C)C(=O)N(CC=C)CCS(=O)(=O)O)s2)cc1F |
| InChI | InChI=1S/C22H26FN3O6S2.ClH/c1-4-9-26(10-11-34(29,30)31)21(28)22(2,3)13-15-6-8-18(33-15)20(27)32-14-5-7-16(19(24)25)17(23)12-14;/h4-8,12H,1,9-11,13H2,2-3H3,(H3,24,25)(H,29,30,31);1H |
| InChIKey | IOCQRZQLSZKSJU-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 150.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.06 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|