C17H25ClN6O — CID 140626203
1-(6-chloro-2-pyridinyl)-3-cyano-2-(1-hydroxy-2,2,7,7-tetramethylazepan-4-yl)guanidine (PubChem CID 140626203) has the molecular formula C17H25ClN6O and a molecular weight of 364.88 g/mol. Its IUPAC name is 1-(6-chloro-2-pyridinyl)-3-cyano-2-(1-hydroxy-2,2,7,7-tetramethylazepan-4-yl)guanidine.
| Compound Name | 1-(6-chloro-2-pyridinyl)-3-cyano-2-(1-hydroxy-2,2,7,7-tetramethylazepan-4-yl)guanidine |
|---|---|
| PubChem CID | 140626203 |
| Molecular Formula | C17H25ClN6O |
| Molecular Weight | 364.88 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 1-(6-chloro-2-pyridinyl)-3-cyano-2-(1-hydroxy-2,2,7,7-tetramethylazepan-4-yl)guanidine |
| SMILES | CC1(C)CCC(/N=C(\NC#N)Nc2cccc(Cl)n2)CC(C)(C)N1O |
| InChI | InChI=1S/C17H25ClN6O/c1-16(2)9-8-12(10-17(3,4)24(16)25)21-15(20-11-19)23-14-7-5-6-13(18)22-14/h5-7,12,25H,8-10H2,1-4H3,(H2,20,21,22,23) |
| InChIKey | OIFICUHAIIFLFY-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 96.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.88 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|