C32H38LiN5O6 — CID 140627488
lithium (3S)-1-[(2S)-2-[[(2S)-2-[[2-[3-[6-[(1R)-1-hydroxyethyl]isoquinolin-3-yl]phenyl]acetyl]amino]-3-methylbutanoyl]amino]propanoyl]diazinane-3-carboxylate (PubChem CID 140627488) has the molecular formula C32H38LiN5O6 and a molecular weight of 595.63 g/mol. Its IUPAC name is lithium (3S)-1-[(2S)-2-[[(2S)-2-[[2-[3-[6-[(1R)-1-hydroxyethyl]isoquinolin-3-yl]phenyl]acetyl]amino]-3-methylbutanoyl]amino]propanoyl]diazinane-3-carboxylate.
| Compound Name | lithium (3S)-1-[(2S)-2-[[(2S)-2-[[2-[3-[6-[(1R)-1-hydroxyethyl]isoquinolin-3-yl]phenyl]acetyl]amino]-3-methylbutanoyl]amino]propanoyl]diazinane-3-carboxylate |
|---|---|
| PubChem CID | 140627488 |
| Molecular Formula | C32H38LiN5O6 |
| Molecular Weight | 595.63 g/mol |
| Exact Mass | 595.30 |
| IUPAC Name | lithium (3S)-1-[(2S)-2-[[(2S)-2-[[2-[3-[6-[(1R)-1-hydroxyethyl]isoquinolin-3-yl]phenyl]acetyl]amino]-3-methylbutanoyl]amino]propanoyl]diazinane-3-carboxylate |
| SMILES | CC(C)[C@H](NC(=O)Cc1cccc(-c2cc3cc([C@@H](C)O)ccc3cn2)c1)C(=O)N[C@@H](C)C(=O)N1CCC[C@@H](C(=O)[O-])N1.[Li+] |
| InChI | InChI=1S/C32H39N5O6.Li/c1-18(2)29(30(40)34-19(3)31(41)37-12-6-9-26(36-37)32(42)43)35-28(39)14-21-7-5-8-23(13-21)27-16-25-15-22(20(4)38)10-11-24(25)17-33-27;/h5,7-8,10-11,13,15-20,26,29,36,38H,6,9,12,14H2,1-4H3,(H,34,40)(H,35,39)(H,42,43);/q;+1/p-1/t19-,20+,26-,29-;/m0./s1 |
| InChIKey | XFLJQSGTSJNEQH-HPOMHLOCSA-M |
| XLogP | -1.61 |
| TPSA | 163.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.63 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |