C13H22N3O4PS — CID 14062771
5-(2-diethoxyphosphoryl-1-ethoxyethyl)-6-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazole (PubChem CID 14062771) has the molecular formula C13H22N3O4PS and a molecular weight of 347.38 g/mol. Its IUPAC name is 5-(2-diethoxyphosphoryl-1-ethoxyethyl)-6-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazole.
| Compound Name | 5-(2-diethoxyphosphoryl-1-ethoxyethyl)-6-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazole |
|---|---|
| PubChem CID | 14062771 |
| Molecular Formula | C13H22N3O4PS |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 5-(2-diethoxyphosphoryl-1-ethoxyethyl)-6-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazole |
| SMILES | CCOC(CP(=O)(OCC)OCC)c1sc2ncnn2c1C |
| InChI | InChI=1S/C13H22N3O4PS/c1-5-18-11(8-21(17,19-6-2)20-7-3)12-10(4)16-13(22-12)14-9-15-16/h9,11H,5-8H2,1-4H3 |
| InChIKey | OEAIGTWKYAAWAC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 74.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|