C43H63N3O8 — CID 140628087
11-[4-tert-butyl-2-(2-methoxyethoxy)phenyl]-5,17-dimethyl-8,14,24,27,32,35-hexaoxa-1,11,21-triazatetracyclo[19.8.8.02,7.015,20]heptatriaconta-2(7),3,5,15(20),16,18-hexaene (PubChem CID 140628087) has the molecular formula C43H63N3O8 and a molecular weight of 749.99 g/mol. Its IUPAC name is 11-[4-tert-butyl-2-(2-methoxyethoxy)phenyl]-5,17-dimethyl-8,14,24,27,32,35-hexaoxa-1,11,21-triazatetracyclo[19.8.8.02,7.015,20]heptatriaconta-2(7),3,5,15(20),16,18-hexaene.
| Compound Name | 11-[4-tert-butyl-2-(2-methoxyethoxy)phenyl]-5,17-dimethyl-8,14,24,27,32,35-hexaoxa-1,11,21-triazatetracyclo[19.8.8.02,7.015,20]heptatriaconta-2(7),3,5,15(20),16,18-hexaene |
|---|---|
| PubChem CID | 140628087 |
| Molecular Formula | C43H63N3O8 |
| Molecular Weight | 749.99 g/mol |
| Exact Mass | 749.46 |
| IUPAC Name | 11-[4-tert-butyl-2-(2-methoxyethoxy)phenyl]-5,17-dimethyl-8,14,24,27,32,35-hexaoxa-1,11,21-triazatetracyclo[19.8.8.02,7.015,20]heptatriaconta-2(7),3,5,15(20),16,18-hexaene |
| SMILES | COCCOc1cc(C(C)(C)C)ccc1N1CCOc2cc(C)ccc2N2CCOCCOCCN(CCOCCOCC2)c2ccc(C)cc2OCC1 |
| InChI | InChI=1S/C43H63N3O8/c1-34-7-10-37-40(31-34)52-23-17-46(39-12-9-36(43(3,4)5)33-42(39)54-30-25-47-6)18-24-53-41-32-35(2)8-11-38(41)45-15-21-50-28-26-48-19-13-44(37)14-20-49-27-29-51-22-16-45/h7-12,31-33H,13-30H2,1-6H3 |
| InChIKey | JICZVGNVGJYGAG-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 83.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.99 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|