C40H38ClFN8O — CID 140628513
N-[(1R)-3-[[2-(5-chloro-1-tritylpyrazolo[5,4-b]pyridin-3-yl)-5-fluoropyrimidin-4-yl]amino]cyclohexyl]pyrrolidine-1-carboxamide (PubChem CID 140628513) has the molecular formula C40H38ClFN8O and a molecular weight of 701.25 g/mol. Its IUPAC name is N-[(1R)-3-[[2-(5-chloro-1-tritylpyrazolo[5,4-b]pyridin-3-yl)-5-fluoropyrimidin-4-yl]amino]cyclohexyl]pyrrolidine-1-carboxamide.
| Compound Name | N-[(1R)-3-[[2-(5-chloro-1-tritylpyrazolo[5,4-b]pyridin-3-yl)-5-fluoropyrimidin-4-yl]amino]cyclohexyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 140628513 |
| Molecular Formula | C40H38ClFN8O |
| Molecular Weight | 701.25 g/mol |
| Exact Mass | 700.28 |
| IUPAC Name | N-[(1R)-3-[[2-(5-chloro-1-tritylpyrazolo[5,4-b]pyridin-3-yl)-5-fluoropyrimidin-4-yl]amino]cyclohexyl]pyrrolidine-1-carboxamide |
| SMILES | O=C(N[C@@H]1CCCC(Nc2nc(-c3nn(C(c4ccccc4)(c4ccccc4)c4ccccc4)c4ncc(Cl)cc34)ncc2F)C1)N1CCCC1 |
| InChI | InChI=1S/C40H38ClFN8O/c41-30-23-33-35(37-43-26-34(42)36(47-37)45-31-19-12-20-32(24-31)46-39(51)49-21-10-11-22-49)48-50(38(33)44-25-30)40(27-13-4-1-5-14-27,28-15-6-2-7-16-28)29-17-8-3-9-18-29/h1-9,13-18,23,25-26,31-32H,10-12,19-22,24H2,(H,46,51)(H,43,45,47)/t31?,32-/m1/s1 |
| InChIKey | RCQPFLYCJVYEED-IADGFXSZSA-N |
| XLogP | 8.05 |
| TPSA | 100.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.25 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|