C17H24O4 — CID 140628557
3-O-(3-methylbutyl) 2-O-propyl bicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate (PubChem CID 140628557) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is 3-O-(3-methylbutyl) 2-O-propyl bicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate.
| Compound Name | 3-O-(3-methylbutyl) 2-O-propyl bicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 140628557 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 3-O-(3-methylbutyl) 2-O-propyl bicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
| SMILES | CCCOC(=O)C1=C(C(=O)OCCC(C)C)C2C=CC1C2 |
| InChI | InChI=1S/C17H24O4/c1-4-8-20-16(18)14-12-5-6-13(10-12)15(14)17(19)21-9-7-11(2)3/h5-6,11-13H,4,7-10H2,1-3H3 |
| InChIKey | QNJMFSLURLPYCM-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|