C32H44N4O5 — CID 140630754
(1R,18R,22R,26S,29S,30S)-26-tert-butyl-30-ethyl-24,27-dioxo-2,23-dioxa-4,11,25,28-tetrazapentacyclo[26.2.1.03,12.05,10.018,22]hentriaconta-3,5,7,9,11-pentaene-29-carbaldehyde (PubChem CID 140630754) has the molecular formula C32H44N4O5 and a molecular weight of 564.73 g/mol. Its IUPAC name is (1R,18R,22R,26S,29S,30S)-26-tert-butyl-30-ethyl-24,27-dioxo-2,23-dioxa-4,11,25,28-tetrazapentacyclo[26.2.1.03,12.05,10.018,22]hentriaconta-3,5,7,9,11-pentaene-29-carbaldehyde.
| Compound Name | (1R,18R,22R,26S,29S,30S)-26-tert-butyl-30-ethyl-24,27-dioxo-2,23-dioxa-4,11,25,28-tetrazapentacyclo[26.2.1.03,12.05,10.018,22]hentriaconta-3,5,7,9,11-pentaene-29-carbaldehyde |
|---|---|
| PubChem CID | 140630754 |
| Molecular Formula | C32H44N4O5 |
| Molecular Weight | 564.73 g/mol |
| Exact Mass | 564.33 |
| IUPAC Name | (1R,18R,22R,26S,29S,30S)-26-tert-butyl-30-ethyl-24,27-dioxo-2,23-dioxa-4,11,25,28-tetrazapentacyclo[26.2.1.03,12.05,10.018,22]hentriaconta-3,5,7,9,11-pentaene-29-carbaldehyde |
| SMILES | CC[C@@H]1[C@@H]2CN(C(=O)[C@H](C(C)(C)C)NC(=O)O[C@@H]3CCC[C@H]3CCCCCc3nc4ccccc4nc3O2)[C@@H]1C=O |
| InChI | InChI=1S/C32H44N4O5/c1-5-21-25(19-37)36-18-27(21)40-29-24(33-22-14-9-10-15-23(22)34-29)16-8-6-7-12-20-13-11-17-26(20)41-31(39)35-28(30(36)38)32(2,3)4/h9-10,14-15,19-21,25-28H,5-8,11-13,16-18H2,1-4H3,(H,35,39)/t20-,21+,25-,26-,27+,28-/m1/s1 |
| InChIKey | ODCXJKARPWCTMR-YYUXZJDVSA-N |
| XLogP | 5.24 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.73 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|