About CID 140631832
CID 140631832 (PubChem CID 140631832) has the molecular formula C31H35Si
and a molecular weight of 435.71 g/mol.
Molecular Properties
| Compound Name | CID 140631832 |
| PubChem CID | 140631832 |
| Molecular Formula | C31H35Si |
| Molecular Weight | 435.71 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | — |
| SMILES | CC1=C(C)C(C)([Si](c2ccccc2)c2ccccc2)C(c2cccc(C(C)(C)C)c2)=C1C |
| InChI | InChI=1S/C31H35Si/c1-22-23(2)29(25-15-14-16-26(21-25)30(4,5)6)31(7,24(22)3)32(27-17-10-8-11-18-27)28-19-12-9-13-20-28/h8-21H,1-7H3 |
| InChIKey | PXIJCEDLJWKXSX-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 435.71 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 140631832 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140631832?
The IUPAC name of CID 140631832 (CID 140631832) is not available.
What is the SMILES notation for CID 140631832?
The canonical SMILES for CID 140631832 is CC1=C(C)C(C)([Si](c2ccccc2)c2ccccc2)C(c2cccc(C(C)(C)C)c2)=C1C.
What is the InChIKey of CID 140631832?
The InChIKey is PXIJCEDLJWKXSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H35Si/c1-22-23(2)29(25-15-14-16-26(21-25)30(4,5)6)31(7,24(22)3)32(27-17-10-8-11-18-27)28-19-12-9-13-20-28/h8-21H,1-7H3.
What are the key properties of CID 140631832?
CID 140631832 has a molecular weight of 435.71 g/mol, XLogP of 7.18, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140631832 is sourced from PubChem (CID 140631832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).