C27H19F8N5O4 — CID 140633207
[5-(2,6-difluorophenyl)-3-[6-(piperidin-3-ylmethyl)pyrazin-2-yl]-1-(2,2,2-trifluoroacetyl)oxyindazol-4-yl] 2,2,2-trifluoroacetate (PubChem CID 140633207) has the molecular formula C27H19F8N5O4 and a molecular weight of 629.46 g/mol. Its IUPAC name is [5-(2,6-difluorophenyl)-3-[6-(piperidin-3-ylmethyl)pyrazin-2-yl]-1-(2,2,2-trifluoroacetyl)oxyindazol-4-yl] 2,2,2-trifluoroacetate.
| Compound Name | [5-(2,6-difluorophenyl)-3-[6-(piperidin-3-ylmethyl)pyrazin-2-yl]-1-(2,2,2-trifluoroacetyl)oxyindazol-4-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 140633207 |
| Molecular Formula | C27H19F8N5O4 |
| Molecular Weight | 629.46 g/mol |
| Exact Mass | 629.13 |
| IUPAC Name | [5-(2,6-difluorophenyl)-3-[6-(piperidin-3-ylmethyl)pyrazin-2-yl]-1-(2,2,2-trifluoroacetyl)oxyindazol-4-yl] 2,2,2-trifluoroacetate |
| SMILES | O=C(Oc1c(-c2c(F)cccc2F)ccc2c1c(-c1cncc(CC3CCCNC3)n1)nn2OC(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C27H19F8N5O4/c28-16-4-1-5-17(29)20(16)15-6-7-19-21(23(15)43-24(41)26(30,31)32)22(39-40(19)44-25(42)27(33,34)35)18-12-37-11-14(38-18)9-13-3-2-8-36-10-13/h1,4-7,11-13,36H,2-3,8-10H2 |
| InChIKey | LWAMYIVLPKECGL-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.46 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|