C54H99B — CID 140633537
tris[(9Z,12Z)-octadeca-9,12-dienyl]borane (PubChem CID 140633537) has the molecular formula C54H99B and a molecular weight of 759.20 g/mol. Its IUPAC name is tris[(9Z,12Z)-octadeca-9,12-dienyl]borane.
| Compound Name | tris[(9Z,12Z)-octadeca-9,12-dienyl]borane |
|---|---|
| PubChem CID | 140633537 |
| Molecular Formula | C54H99B |
| Molecular Weight | 759.20 g/mol |
| Exact Mass | 758.78 |
| IUPAC Name | tris[(9Z,12Z)-octadeca-9,12-dienyl]borane |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCB(CCCCCCCC/C=C\C/C=C\CCCCC)CCCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C54H99B/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-46-49-52-55(53-50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-5-2)54-51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-6-3/h16-21,25-30H,4-15,22-24,31-54H2,1-3H3/b19-16-,20-17-,21-18-,28-25-,29-26-,30-27- |
| InChIKey | RCCBQNRKSBEUIE-BBWANDEASA-N |
| XLogP | 19.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 45 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.20 |
| LogP ≤ 5 | 19.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|