C15H24O4 — CID 140633955
7-hydroxy-2-(4-hydroxycyclohexyl)-2,3,4a,5,6,7,8,8a-octahydrochromen-4-one (PubChem CID 140633955) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is 7-hydroxy-2-(4-hydroxycyclohexyl)-2,3,4a,5,6,7,8,8a-octahydrochromen-4-one.
| Compound Name | 7-hydroxy-2-(4-hydroxycyclohexyl)-2,3,4a,5,6,7,8,8a-octahydrochromen-4-one |
|---|---|
| PubChem CID | 140633955 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 7-hydroxy-2-(4-hydroxycyclohexyl)-2,3,4a,5,6,7,8,8a-octahydrochromen-4-one |
| SMILES | O=C1CC(C2CCC(O)CC2)OC2CC(O)CCC12 |
| InChI | InChI=1S/C15H24O4/c16-10-3-1-9(2-4-10)14-8-13(18)12-6-5-11(17)7-15(12)19-14/h9-12,14-17H,1-8H2 |
| InChIKey | GZFYIZMUMTXZFX-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |