C17H28O6 — CID 140633960
5-hydroxy-2-(3-hydroxy-4-methoxycyclohexyl)-7-methoxy-2,3,4a,5,6,7,8,8a-octahydrochromen-4-one (PubChem CID 140633960) has the molecular formula C17H28O6 and a molecular weight of 328.41 g/mol. Its IUPAC name is 5-hydroxy-2-(3-hydroxy-4-methoxycyclohexyl)-7-methoxy-2,3,4a,5,6,7,8,8a-octahydrochromen-4-one.
| Compound Name | 5-hydroxy-2-(3-hydroxy-4-methoxycyclohexyl)-7-methoxy-2,3,4a,5,6,7,8,8a-octahydrochromen-4-one |
|---|---|
| PubChem CID | 140633960 |
| Molecular Formula | C17H28O6 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 5-hydroxy-2-(3-hydroxy-4-methoxycyclohexyl)-7-methoxy-2,3,4a,5,6,7,8,8a-octahydrochromen-4-one |
| SMILES | COC1CC(O)C2C(=O)CC(C3CCC(OC)C(O)C3)OC2C1 |
| InChI | InChI=1S/C17H28O6/c1-21-10-6-12(19)17-13(20)8-15(23-16(17)7-10)9-3-4-14(22-2)11(18)5-9/h9-12,14-19H,3-8H2,1-2H3 |
| InChIKey | IZIJQIONCLSZLI-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |