C15H32N2 — CID 140634581
3,5-bis(3-methylpentan-3-yl)pyrazolidine (PubChem CID 140634581) has the molecular formula C15H32N2 and a molecular weight of 240.43 g/mol. Its IUPAC name is 3,5-bis(3-methylpentan-3-yl)pyrazolidine.
| Compound Name | 3,5-bis(3-methylpentan-3-yl)pyrazolidine |
|---|---|
| PubChem CID | 140634581 |
| Molecular Formula | C15H32N2 |
| Molecular Weight | 240.43 g/mol |
| Exact Mass | 240.26 |
| IUPAC Name | 3,5-bis(3-methylpentan-3-yl)pyrazolidine |
| SMILES | CCC(C)(CC)C1CC(C(C)(CC)CC)NN1 |
| InChI | InChI=1S/C15H32N2/c1-7-14(5,8-2)12-11-13(17-16-12)15(6,9-3)10-4/h12-13,16-17H,7-11H2,1-6H3 |
| InChIKey | DOCQIVQXAWLYTI-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.43 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |