C18H17F4N5O3 — CID 140635011
[3-ethyl-6-fluoro-1-(5-piperidin-4-yl-1,2,4-oxadiazol-3-yl)indazol-4-yl] 2,2,2-trifluoroacetate (PubChem CID 140635011) has the molecular formula C18H17F4N5O3 and a molecular weight of 427.36 g/mol. Its IUPAC name is [3-ethyl-6-fluoro-1-(5-piperidin-4-yl-1,2,4-oxadiazol-3-yl)indazol-4-yl] 2,2,2-trifluoroacetate.
| Compound Name | [3-ethyl-6-fluoro-1-(5-piperidin-4-yl-1,2,4-oxadiazol-3-yl)indazol-4-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 140635011 |
| Molecular Formula | C18H17F4N5O3 |
| Molecular Weight | 427.36 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | [3-ethyl-6-fluoro-1-(5-piperidin-4-yl-1,2,4-oxadiazol-3-yl)indazol-4-yl] 2,2,2-trifluoroacetate |
| SMILES | CCc1nn(-c2noc(C3CCNCC3)n2)c2cc(F)cc(OC(=O)C(F)(F)F)c12 |
| InChI | InChI=1S/C18H17F4N5O3/c1-2-11-14-12(7-10(19)8-13(14)29-16(28)18(20,21)22)27(25-11)17-24-15(30-26-17)9-3-5-23-6-4-9/h7-9,23H,2-6H2,1H3 |
| InChIKey | BAYZTJRYFPMMDL-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 95.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.36 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|