C10H16FO7- — CID 140635530
methyl (2R,3R)-3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-fluoro-2-methyl-3-oxidoperoxypropanoate (PubChem CID 140635530) has the molecular formula C10H16FO7- and a molecular weight of 267.23 g/mol. Its IUPAC name is methyl (2R,3R)-3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-fluoro-2-methyl-3-oxidoperoxypropanoate.
| Compound Name | methyl (2R,3R)-3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-fluoro-2-methyl-3-oxidoperoxypropanoate |
|---|---|
| PubChem CID | 140635530 |
| Molecular Formula | C10H16FO7- |
| Molecular Weight | 267.23 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | methyl (2R,3R)-3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-fluoro-2-methyl-3-oxidoperoxypropanoate |
| SMILES | COC(=O)[C@](C)(F)[C@H](OO[O-])C1COC(C)(C)O1 |
| InChI | InChI=1S/C10H17FO7/c1-9(2)15-5-6(16-9)7(17-18-13)10(3,11)8(12)14-4/h6-7,13H,5H2,1-4H3/p-1/t6?,7-,10-/m1/s1 |
| InChIKey | SZKBAZMYHBRSAP-PZUJBFCGSA-M |
| XLogP | -0.37 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.23 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|