C44H51ClN2O5 — CID 140635639
N-[[2-(4-chlorophenoxy)phenyl]methyl]-11-cyano-14a-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-3,4,5,6,7,8,8a,14b-octahydro-1H-picene-2-carboxamide (PubChem CID 140635639) has the molecular formula C44H51ClN2O5 and a molecular weight of 723.35 g/mol. Its IUPAC name is N-[[2-(4-chlorophenoxy)phenyl]methyl]-11-cyano-14a-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-3,4,5,6,7,8,8a,14b-octahydro-1H-picene-2-carboxamide.
| Compound Name | N-[[2-(4-chlorophenoxy)phenyl]methyl]-11-cyano-14a-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-3,4,5,6,7,8,8a,14b-octahydro-1H-picene-2-carboxamide |
|---|---|
| PubChem CID | 140635639 |
| Molecular Formula | C44H51ClN2O5 |
| Molecular Weight | 723.35 g/mol |
| Exact Mass | 722.35 |
| IUPAC Name | N-[[2-(4-chlorophenoxy)phenyl]methyl]-11-cyano-14a-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-3,4,5,6,7,8,8a,14b-octahydro-1H-picene-2-carboxamide |
| SMILES | CC1(C(=O)NCc2ccccc2Oc2ccc(Cl)cc2)CCC2(C)CCC3(C)C4(C)CCC5C(C)(C)C(=O)C(C#N)=CC5(C)C4=CC(=O)C3(O)C2C1 |
| InChI | InChI=1S/C44H51ClN2O5/c1-38(2)32-16-17-42(6)33(41(32,5)23-28(25-46)36(38)49)22-35(48)44(51)34-24-40(4,19-18-39(34,3)20-21-43(42,44)7)37(50)47-26-27-10-8-9-11-31(27)52-30-14-12-29(45)13-15-30/h8-15,22-23,32,34,51H,16-21,24,26H2,1-7H3,(H,47,50) |
| InChIKey | QDYSQSNJMGBXQX-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 116.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.35 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |