C26H30ClN3O5 — CID 140636176
8-chloro-9-[(5-cyclohexyloxy-2-pyridinyl)methylamino]spiro[1,2,3,4-tetrahydro-3-benzazepine-5,2'-1,3-dioxepane]-4',7'-dione (PubChem CID 140636176) has the molecular formula C26H30ClN3O5 and a molecular weight of 500.00 g/mol. Its IUPAC name is 8-chloro-9-[(5-cyclohexyloxy-2-pyridinyl)methylamino]spiro[1,2,3,4-tetrahydro-3-benzazepine-5,2'-1,3-dioxepane]-4',7'-dione.
| Compound Name | 8-chloro-9-[(5-cyclohexyloxy-2-pyridinyl)methylamino]spiro[1,2,3,4-tetrahydro-3-benzazepine-5,2'-1,3-dioxepane]-4',7'-dione |
|---|---|
| PubChem CID | 140636176 |
| Molecular Formula | C26H30ClN3O5 |
| Molecular Weight | 500.00 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | 8-chloro-9-[(5-cyclohexyloxy-2-pyridinyl)methylamino]spiro[1,2,3,4-tetrahydro-3-benzazepine-5,2'-1,3-dioxepane]-4',7'-dione |
| SMILES | O=C1CCC(=O)OC2(CNCCc3c2ccc(Cl)c3NCc2ccc(OC3CCCCC3)cn2)O1 |
| InChI | InChI=1S/C26H30ClN3O5/c27-22-9-8-21-20(12-13-28-16-26(21)34-23(31)10-11-24(32)35-26)25(22)30-14-17-6-7-19(15-29-17)33-18-4-2-1-3-5-18/h6-9,15,18,28,30H,1-5,10-14,16H2 |
| InChIKey | IDYVTMDFORTZRE-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.00 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |