C7H8N3NaO5S — CID 140637096
sodium [(2R,5R)-2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate (PubChem CID 140637096) has the molecular formula C7H8N3NaO5S and a molecular weight of 269.21 g/mol. Its IUPAC name is sodium [(2R,5R)-2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate.
| Compound Name | sodium [(2R,5R)-2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
|---|---|
| PubChem CID | 140637096 |
| Molecular Formula | C7H8N3NaO5S |
| Molecular Weight | 269.21 g/mol |
| Exact Mass | 269.01 |
| IUPAC Name | sodium [(2R,5R)-2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
| SMILES | [C-]#[N+][C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C7H9N3O5S.Na/c1-8-6-3-2-5-4-9(6)7(11)10(5)15-16(12,13)14;/h5-6H,2-4H2,(H,12,13,14);/q;+1/p-1/t5-,6+;/m1./s1 |
| InChIKey | IWEBAQTYZKYEGJ-IBTYICNHSA-M |
| XLogP | -3.47 |
| TPSA | 94.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.21 |
| LogP ≤ 5 | -3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|