C26H29ClN2O3 — CID 140637197
(3R,8Z,11S)-11-[3-(4-chlorophenyl)-2-oxopropyl]-1-methyl-3-phenyl-1,4-diazacyclododec-8-ene-5,12-dione (PubChem CID 140637197) has the molecular formula C26H29ClN2O3 and a molecular weight of 452.98 g/mol. Its IUPAC name is (3R,8Z,11S)-11-[3-(4-chlorophenyl)-2-oxopropyl]-1-methyl-3-phenyl-1,4-diazacyclododec-8-ene-5,12-dione.
| Compound Name | (3R,8Z,11S)-11-[3-(4-chlorophenyl)-2-oxopropyl]-1-methyl-3-phenyl-1,4-diazacyclododec-8-ene-5,12-dione |
|---|---|
| PubChem CID | 140637197 |
| Molecular Formula | C26H29ClN2O3 |
| Molecular Weight | 452.98 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | (3R,8Z,11S)-11-[3-(4-chlorophenyl)-2-oxopropyl]-1-methyl-3-phenyl-1,4-diazacyclododec-8-ene-5,12-dione |
| SMILES | CN1C[C@@H](c2ccccc2)NC(=O)CC/C=C\C[C@@H](CC(=O)Cc2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C26H29ClN2O3/c1-29-18-24(20-8-4-2-5-9-20)28-25(31)11-7-3-6-10-21(26(29)32)17-23(30)16-19-12-14-22(27)15-13-19/h2-6,8-9,12-15,21,24H,7,10-11,16-18H2,1H3,(H,28,31)/b6-3-/t21-,24-/m0/s1 |
| InChIKey | WGILQCGNEKSRIP-WSQHAGRXSA-N |
| XLogP | 4.51 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.98 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|