C24H34N2O5 — CID 140637281
2-[(2R,3S,6S,8Z)-3,4-dimethyl-5,12-dioxo-2-phenyl-1-oxa-4-azacyclododec-8-en-6-yl]-N-(2-ethoxyethyl)acetamide (PubChem CID 140637281) has the molecular formula C24H34N2O5 and a molecular weight of 430.55 g/mol. Its IUPAC name is 2-[(2R,3S,6S,8Z)-3,4-dimethyl-5,12-dioxo-2-phenyl-1-oxa-4-azacyclododec-8-en-6-yl]-N-(2-ethoxyethyl)acetamide.
| Compound Name | 2-[(2R,3S,6S,8Z)-3,4-dimethyl-5,12-dioxo-2-phenyl-1-oxa-4-azacyclododec-8-en-6-yl]-N-(2-ethoxyethyl)acetamide |
|---|---|
| PubChem CID | 140637281 |
| Molecular Formula | C24H34N2O5 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | 2-[(2R,3S,6S,8Z)-3,4-dimethyl-5,12-dioxo-2-phenyl-1-oxa-4-azacyclododec-8-en-6-yl]-N-(2-ethoxyethyl)acetamide |
| SMILES | CCOCCNC(=O)C[C@@H]1C/C=C\CCC(=O)O[C@H](c2ccccc2)[C@H](C)N(C)C1=O |
| InChI | InChI=1S/C24H34N2O5/c1-4-30-16-15-25-21(27)17-20-13-9-6-10-14-22(28)31-23(18(2)26(3)24(20)29)19-11-7-5-8-12-19/h5-9,11-12,18,20,23H,4,10,13-17H2,1-3H3,(H,25,27)/b9-6-/t18-,20-,23-/m0/s1 |
| InChIKey | XBKPFPPDJIVNOO-BXFRXTDVSA-N |
| XLogP | 3.02 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|