C23H32BNO4 — CID 140637600
2-hydroxy-3-(2-oxopropyl)-2-[(E)-2-phenylethenyl]-3-[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-1-oxa-3-azonia-2-boranuidacyclopentan-5-one (PubChem CID 140637600) has the molecular formula C23H32BNO4 and a molecular weight of 397.32 g/mol. Its IUPAC name is 2-hydroxy-3-(2-oxopropyl)-2-[(E)-2-phenylethenyl]-3-[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-1-oxa-3-azonia-2-boranuidacyclopentan-5-one.
| Compound Name | 2-hydroxy-3-(2-oxopropyl)-2-[(E)-2-phenylethenyl]-3-[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-1-oxa-3-azonia-2-boranuidacyclopentan-5-one |
|---|---|
| PubChem CID | 140637600 |
| Molecular Formula | C23H32BNO4 |
| Molecular Weight | 397.32 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | 2-hydroxy-3-(2-oxopropyl)-2-[(E)-2-phenylethenyl]-3-[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-1-oxa-3-azonia-2-boranuidacyclopentan-5-one |
| SMILES | CC(=O)C[N+]1([C@@H]2C[C@@H]3C[C@H]([C@H]2C)C3(C)C)CC(=O)O[B-]1(O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C23H32BNO4/c1-16(26)14-25(21-13-19-12-20(17(21)2)23(19,3)4)15-22(27)29-24(25,28)11-10-18-8-6-5-7-9-18/h5-11,17,19-21,28H,12-15H2,1-4H3/b11-10+/t17-,19+,20-,21-,24?,25?/m1/s1 |
| InChIKey | YJIPMLKLORRICA-XTTGXJGMSA-N |
| XLogP | 3.20 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.32 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|