C20H20BNO4 — CID 140637625
2-[(E)-2-phenylethenyl]-6-(1-phenylethyl)-1,3,6,2-dioxazaborocane-4,8-dione (PubChem CID 140637625) has the molecular formula C20H20BNO4 and a molecular weight of 349.20 g/mol. Its IUPAC name is 2-[(E)-2-phenylethenyl]-6-(1-phenylethyl)-1,3,6,2-dioxazaborocane-4,8-dione.
| Compound Name | 2-[(E)-2-phenylethenyl]-6-(1-phenylethyl)-1,3,6,2-dioxazaborocane-4,8-dione |
|---|---|
| PubChem CID | 140637625 |
| Molecular Formula | C20H20BNO4 |
| Molecular Weight | 349.20 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 2-[(E)-2-phenylethenyl]-6-(1-phenylethyl)-1,3,6,2-dioxazaborocane-4,8-dione |
| SMILES | CC(c1ccccc1)N1CC(=O)OB(/C=C/c2ccccc2)OC(=O)C1 |
| InChI | InChI=1S/C20H20BNO4/c1-16(18-10-6-3-7-11-18)22-14-19(23)25-21(26-20(24)15-22)13-12-17-8-4-2-5-9-17/h2-13,16H,14-15H2,1H3/b13-12+ |
| InChIKey | FUYDILIHFDLRCO-OUKQBFOZSA-N |
| XLogP | 2.89 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.20 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|