About CID 140637910
CID 140637910 (PubChem CID 140637910) has the molecular formula C71H88N9O8
and a molecular weight of 1195.54 g/mol.
Molecular Properties
| Compound Name | CID 140637910 |
| PubChem CID | 140637910 |
| Molecular Formula | C71H88N9O8 |
| Molecular Weight | 1195.54 g/mol |
| Exact Mass | 1194.68 |
| IUPAC Name | — |
| SMILES | C[C@H](c1ccccc1)N(CC(=O)N(CC(=O)N(CC(=O)N(CC(=O)N(CC(=O)N(CC(N)=O)[C@@H](C)c1ccccc1)[C@@H](C)c1ccccc1)[C@@H](C)c1ccccc1)[C@H](C)c1ccccc1)[C@H](C)c1ccccc1)C(=O)CNC1CC(C)(C)N([O])C(C)(C)C1 |
| InChI | InChI=1S/C71H88N9O8/c1-50(56-29-17-11-18-30-56)74(44-63(72)81)65(83)46-76(52(3)58-33-21-13-22-34-58)67(85)48-78(54(5)60-37-25-15-26-38-60)69(87)49-79(55(6)61-39-27-16-28-40-61)68(86)47-77(53(4)59-35-23-14-24-36-59)66(84)45-75(51(2)57-31-19-12-20-32-57)64(82)43-73-62-41-70(7,8)80(88)71(9,10)42-62/h11-40,50-55,62,73H,41-49H2,1-10H3,(H2,72,81)/t50-,51+,52-,53+,54-,55+/m0/s1 |
| InChIKey | NMJSIKLIDGSOOX-WLSZEVRESA-N |
| XLogP | 9.97 |
| TPSA | 200.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 88 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1195.54 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze CID 140637910 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140637910?
The IUPAC name of CID 140637910 (CID 140637910) is not available.
What is the SMILES notation for CID 140637910?
The canonical SMILES for CID 140637910 is C[C@H](c1ccccc1)N(CC(=O)N(CC(=O)N(CC(=O)N(CC(=O)N(CC(=O)N(CC(N)=O)[C@@H](C)c1ccccc1)[C@@H](C)c1ccccc1)[C@@H](C)c1ccccc1)[C@H](C)c1ccccc1)[C@H](C)c1ccccc1)C(=O)CNC1CC(C)(C)N([O])C(C)(C)C1.
What is the InChIKey of CID 140637910?
The InChIKey is NMJSIKLIDGSOOX-WLSZEVRESA-N. The full InChI is InChI=1S/C71H88N9O8/c1-50(56-29-17-11-18-30-56)74(44-63(72)81)65(83)46-76(52(3)58-33-21-13-22-34-58)67(85)48-78(54(5)60-37-25-15-26-38-60)69(87)49-79(55(6)61-39-27-16-28-40-61)68(86)47-77(53(4)59-35-23-14-24-36-59)66(84)45-75(51(2)57-31-19-12-20-32-57)64(82)43-73-62-41-70(7,8)80(88)71(9,10)42-62/h11-40,50-55,62,73H,41-49H2,1-10H3,(H2,72,81)/t50-,51+,52-,53+,54-,55+/m0/s1.
What are the key properties of CID 140637910?
CID 140637910 has a molecular weight of 1195.54 g/mol, XLogP of 9.97, 27 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140637910 is sourced from PubChem (CID 140637910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).