C24H33N6O6PS — CID 140638025
[[(2R,3R,5R)-2-(deuteriomethyl)-5-(7-nitro-2-oxo-10H-pyrimido[5,4-b][1,4]benzothiazin-3-yl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl] N-ethylmethanimidate (PubChem CID 140638025) has the molecular formula C24H33N6O6PS and a molecular weight of 565.61 g/mol. Its IUPAC name is [[(2R,3R,5R)-2-(deuteriomethyl)-5-(7-nitro-2-oxo-10H-pyrimido[5,4-b][1,4]benzothiazin-3-yl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl] N-ethylmethanimidate.
| Compound Name | [[(2R,3R,5R)-2-(deuteriomethyl)-5-(7-nitro-2-oxo-10H-pyrimido[5,4-b][1,4]benzothiazin-3-yl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl] N-ethylmethanimidate |
|---|---|
| PubChem CID | 140638025 |
| Molecular Formula | C24H33N6O6PS |
| Molecular Weight | 565.61 g/mol |
| Exact Mass | 565.20 |
| IUPAC Name | [[(2R,3R,5R)-2-(deuteriomethyl)-5-(7-nitro-2-oxo-10H-pyrimido[5,4-b][1,4]benzothiazin-3-yl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl] N-ethylmethanimidate |
| SMILES | [2H]C[C@H]1O[C@@H](n2cc3c(nc2=O)Nc2ccc([N+](=O)[O-])cc2S3)C[C@H]1OP(O/C=N/CC)N(C(C)C)C(C)C |
| InChI | InChI=1S/C24H33N6O6PS/c1-7-25-13-34-37(29(14(2)3)15(4)5)36-19-11-22(35-16(19)6)28-12-21-23(27-24(28)31)26-18-9-8-17(30(32)33)10-20(18)38-21/h8-10,12-16,19,22H,7,11H2,1-6H3,(H,26,27,31)/b25-13+/t16-,19-,22-,37?/m1/s1/i6D |
| InChIKey | SEAYYVMLROVGLX-YZIZSKCASA-N |
| XLogP | 5.46 |
| TPSA | 133.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.61 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|