About 1-(2-fluoroethyl)-2,3-di(propan-2-yl)-2,3-dihydropyrrole
1-(2-fluoroethyl)-2,3-di(propan-2-yl)-2,3-dihydropyrrole (PubChem CID 140638390) has the molecular formula C12H22FN
and a molecular weight of 199.31 g/mol. Its IUPAC name is 1-(2-fluoroethyl)-2,3-di(propan-2-yl)-2,3-dihydropyrrole.
Molecular Properties
| Compound Name | 1-(2-fluoroethyl)-2,3-di(propan-2-yl)-2,3-dihydropyrrole |
| PubChem CID | 140638390 |
| Molecular Formula | C12H22FN |
| Molecular Weight | 199.31 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | 1-(2-fluoroethyl)-2,3-di(propan-2-yl)-2,3-dihydropyrrole |
| SMILES | CC(C)C1C=CN(CCF)C1C(C)C |
| InChI | InChI=1S/C12H22FN/c1-9(2)11-5-7-14(8-6-13)12(11)10(3)4/h5,7,9-12H,6,8H2,1-4H3 |
| InChIKey | KUIRDVFQTKUZRL-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.31 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(2-fluoroethyl)-2,3-di(propan-2-yl)-2,3-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-fluoroethyl)-2,3-di(propan-2-yl)-2,3-dihydropyrrole?
The IUPAC name of 1-(2-fluoroethyl)-2,3-di(propan-2-yl)-2,3-dihydropyrrole (CID 140638390) is 1-(2-fluoroethyl)-2,3-di(propan-2-yl)-2,3-dihydropyrrole.
What is the SMILES notation for 1-(2-fluoroethyl)-2,3-di(propan-2-yl)-2,3-dihydropyrrole?
The canonical SMILES for 1-(2-fluoroethyl)-2,3-di(propan-2-yl)-2,3-dihydropyrrole is CC(C)C1C=CN(CCF)C1C(C)C.
What is the InChIKey of 1-(2-fluoroethyl)-2,3-di(propan-2-yl)-2,3-dihydropyrrole?
The InChIKey is KUIRDVFQTKUZRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22FN/c1-9(2)11-5-7-14(8-6-13)12(11)10(3)4/h5,7,9-12H,6,8H2,1-4H3.
What are the key properties of 1-(2-fluoroethyl)-2,3-di(propan-2-yl)-2,3-dihydropyrrole?
1-(2-fluoroethyl)-2,3-di(propan-2-yl)-2,3-dihydropyrrole has a molecular weight of 199.31 g/mol, XLogP of 3.08, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-fluoroethyl)-2,3-di(propan-2-yl)-2,3-dihydropyrrole is sourced from PubChem (CID 140638390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).