C15H27N2P — CID 140640189
1-N,1-N,4-N,4-N,3-pentamethyl-3-(phospholan-1-yl)cyclohexa-1,5-diene-1,4-diamine (PubChem CID 140640189) has the molecular formula C15H27N2P and a molecular weight of 266.37 g/mol. Its IUPAC name is 1-N,1-N,4-N,4-N,3-pentamethyl-3-(phospholan-1-yl)cyclohexa-1,5-diene-1,4-diamine.
| Compound Name | 1-N,1-N,4-N,4-N,3-pentamethyl-3-(phospholan-1-yl)cyclohexa-1,5-diene-1,4-diamine |
|---|---|
| PubChem CID | 140640189 |
| Molecular Formula | C15H27N2P |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 1-N,1-N,4-N,4-N,3-pentamethyl-3-(phospholan-1-yl)cyclohexa-1,5-diene-1,4-diamine |
| SMILES | CN(C)C1=CC(C)(P2CCCC2)C(N(C)C)C=C1 |
| InChI | InChI=1S/C15H27N2P/c1-15(18-10-6-7-11-18)12-13(16(2)3)8-9-14(15)17(4)5/h8-9,12,14H,6-7,10-11H2,1-5H3 |
| InChIKey | DSIDRRQRQTYAQB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|