C24H16O3 — CID 140640259
2,2-dinaphthalen-1-yl-3-oxobutanedial (PubChem CID 140640259) has the molecular formula C24H16O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is 2,2-dinaphthalen-1-yl-3-oxobutanedial.
| Compound Name | 2,2-dinaphthalen-1-yl-3-oxobutanedial |
|---|---|
| PubChem CID | 140640259 |
| Molecular Formula | C24H16O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 2,2-dinaphthalen-1-yl-3-oxobutanedial |
| SMILES | O=CC(=O)C(C=O)(c1cccc2ccccc12)c1cccc2ccccc12 |
| InChI | InChI=1S/C24H16O3/c25-15-23(27)24(16-26,21-13-5-9-17-7-1-3-11-19(17)21)22-14-6-10-18-8-2-4-12-20(18)22/h1-16H |
| InChIKey | CYNBSVAGENDABR-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|