C43H39FN4O2 — CID 140640656
2-carbazol-9-yl-6-[[2-[(3-carbazol-9-yl-5-fluoro-2-hydroxyphenyl)methyl-methylamino]ethyl-methylamino]methyl]-4-methylphenol (PubChem CID 140640656) has the molecular formula C43H39FN4O2 and a molecular weight of 662.81 g/mol. Its IUPAC name is 2-carbazol-9-yl-6-[[2-[(3-carbazol-9-yl-5-fluoro-2-hydroxyphenyl)methyl-methylamino]ethyl-methylamino]methyl]-4-methylphenol.
| Compound Name | 2-carbazol-9-yl-6-[[2-[(3-carbazol-9-yl-5-fluoro-2-hydroxyphenyl)methyl-methylamino]ethyl-methylamino]methyl]-4-methylphenol |
|---|---|
| PubChem CID | 140640656 |
| Molecular Formula | C43H39FN4O2 |
| Molecular Weight | 662.81 g/mol |
| Exact Mass | 662.31 |
| IUPAC Name | 2-carbazol-9-yl-6-[[2-[(3-carbazol-9-yl-5-fluoro-2-hydroxyphenyl)methyl-methylamino]ethyl-methylamino]methyl]-4-methylphenol |
| SMILES | Cc1cc(CN(C)CCN(C)Cc2cc(F)cc(-n3c4ccccc4c4ccccc43)c2O)c(O)c(-n2c3ccccc3c3ccccc32)c1 |
| InChI | InChI=1S/C43H39FN4O2/c1-28-22-29(42(49)40(23-28)47-36-16-8-4-12-32(36)33-13-5-9-17-37(33)47)26-45(2)20-21-46(3)27-30-24-31(44)25-41(43(30)50)48-38-18-10-6-14-34(38)35-15-7-11-19-39(35)48/h4-19,22-25,49-50H,20-21,26-27H2,1-3H3 |
| InChIKey | RRKYBTQJFVGEJK-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 56.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.81 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|