C21H23N3O6 — CID 140640963
N,3-dihydroxy-3-[5-(hydroxymethyl)-1,2-oxazol-3-yl]-2-methyl-2-[[4-(5-methyl-2-pyridinyl)phenyl]methoxy]propanamide (PubChem CID 140640963) has the molecular formula C21H23N3O6 and a molecular weight of 413.43 g/mol. Its IUPAC name is N,3-dihydroxy-3-[5-(hydroxymethyl)-1,2-oxazol-3-yl]-2-methyl-2-[[4-(5-methyl-2-pyridinyl)phenyl]methoxy]propanamide.
| Compound Name | N,3-dihydroxy-3-[5-(hydroxymethyl)-1,2-oxazol-3-yl]-2-methyl-2-[[4-(5-methyl-2-pyridinyl)phenyl]methoxy]propanamide |
|---|---|
| PubChem CID | 140640963 |
| Molecular Formula | C21H23N3O6 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | N,3-dihydroxy-3-[5-(hydroxymethyl)-1,2-oxazol-3-yl]-2-methyl-2-[[4-(5-methyl-2-pyridinyl)phenyl]methoxy]propanamide |
| SMILES | Cc1ccc(-c2ccc(COC(C)(C(=O)NO)C(O)c3cc(CO)on3)cc2)nc1 |
| InChI | InChI=1S/C21H23N3O6/c1-13-3-8-17(22-10-13)15-6-4-14(5-7-15)12-29-21(2,20(27)23-28)19(26)18-9-16(11-25)30-24-18/h3-10,19,25-26,28H,11-12H2,1-2H3,(H,23,27) |
| InChIKey | ISTJUUPTGIYCJK-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 137.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|