C17H31F2N7O — CID 140643744
2-amino-6-fluoro-N-(5-fluoro-4-piperidin-1-ylpiperidin-3-yl)-1,2,3,3a,4,5,6,7-octahydropyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 140643744) has the molecular formula C17H31F2N7O and a molecular weight of 387.48 g/mol. Its IUPAC name is 2-amino-6-fluoro-N-(5-fluoro-4-piperidin-1-ylpiperidin-3-yl)-1,2,3,3a,4,5,6,7-octahydropyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | 2-amino-6-fluoro-N-(5-fluoro-4-piperidin-1-ylpiperidin-3-yl)-1,2,3,3a,4,5,6,7-octahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 140643744 |
| Molecular Formula | C17H31F2N7O |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.26 |
| IUPAC Name | 2-amino-6-fluoro-N-(5-fluoro-4-piperidin-1-ylpiperidin-3-yl)-1,2,3,3a,4,5,6,7-octahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | NC1NN2CC(F)CNC2C1C(=O)NC1CNCC(F)C1N1CCCCC1 |
| InChI | InChI=1S/C17H31F2N7O/c18-10-6-22-16-13(15(20)24-26(16)9-10)17(27)23-12-8-21-7-11(19)14(12)25-4-2-1-3-5-25/h10-16,21-22,24H,1-9,20H2,(H,23,27) |
| InChIKey | QBBLNNMXJHEVSY-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 97.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |