C19H33N7O2 — CID 140643760
2-amino-6-(cyanomethyl)-N-(4-cyclopentyloxypiperidin-3-yl)-1,2,3,3a,4,5,6,7-octahydropyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 140643760) has the molecular formula C19H33N7O2 and a molecular weight of 391.52 g/mol. Its IUPAC name is 2-amino-6-(cyanomethyl)-N-(4-cyclopentyloxypiperidin-3-yl)-1,2,3,3a,4,5,6,7-octahydropyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | 2-amino-6-(cyanomethyl)-N-(4-cyclopentyloxypiperidin-3-yl)-1,2,3,3a,4,5,6,7-octahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 140643760 |
| Molecular Formula | C19H33N7O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.27 |
| IUPAC Name | 2-amino-6-(cyanomethyl)-N-(4-cyclopentyloxypiperidin-3-yl)-1,2,3,3a,4,5,6,7-octahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | N#CCC1CNC2C(C(=O)NC3CNCCC3OC3CCCC3)C(N)NN2C1 |
| InChI | InChI=1S/C19H33N7O2/c20-7-5-12-9-23-18-16(17(21)25-26(18)11-12)19(27)24-14-10-22-8-6-15(14)28-13-3-1-2-4-13/h12-18,22-23,25H,1-6,8-11,21H2,(H,24,27) |
| InChIKey | JDEQFZMCXJEXLJ-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 127.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |