C20H36FN7O2 — CID 140643821
2-amino-6-fluoro-N-[4-[1-(oxetan-3-yl)piperidin-4-yl]piperidin-3-yl]-1,2,3,3a,4,5,6,7-octahydropyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 140643821) has the molecular formula C20H36FN7O2 and a molecular weight of 425.55 g/mol. Its IUPAC name is 2-amino-6-fluoro-N-[4-[1-(oxetan-3-yl)piperidin-4-yl]piperidin-3-yl]-1,2,3,3a,4,5,6,7-octahydropyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | 2-amino-6-fluoro-N-[4-[1-(oxetan-3-yl)piperidin-4-yl]piperidin-3-yl]-1,2,3,3a,4,5,6,7-octahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 140643821 |
| Molecular Formula | C20H36FN7O2 |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.29 |
| IUPAC Name | 2-amino-6-fluoro-N-[4-[1-(oxetan-3-yl)piperidin-4-yl]piperidin-3-yl]-1,2,3,3a,4,5,6,7-octahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | NC1NN2CC(F)CNC2C1C(=O)NC1CNCCC1C1CCN(C2COC2)CC1 |
| InChI | InChI=1S/C20H36FN7O2/c21-13-7-24-19-17(18(22)26-28(19)9-13)20(29)25-16-8-23-4-1-15(16)12-2-5-27(6-3-12)14-10-30-11-14/h12-19,23-24,26H,1-11,22H2,(H,25,29) |
| InChIKey | XLGKUIIYJSJHIF-UHFFFAOYSA-N |
| XLogP | -1.82 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |