C16H32N4O — CID 140643885
4-[2-methyl-6-[(3S)-1-methylpyrrolidin-3-yl]oxypiperidin-3-yl]piperidin-3-amine (PubChem CID 140643885) has the molecular formula C16H32N4O and a molecular weight of 296.46 g/mol. Its IUPAC name is 4-[2-methyl-6-[(3S)-1-methylpyrrolidin-3-yl]oxypiperidin-3-yl]piperidin-3-amine.
| Compound Name | 4-[2-methyl-6-[(3S)-1-methylpyrrolidin-3-yl]oxypiperidin-3-yl]piperidin-3-amine |
|---|---|
| PubChem CID | 140643885 |
| Molecular Formula | C16H32N4O |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.26 |
| IUPAC Name | 4-[2-methyl-6-[(3S)-1-methylpyrrolidin-3-yl]oxypiperidin-3-yl]piperidin-3-amine |
| SMILES | CC1NC(O[C@H]2CCN(C)C2)CCC1C1CCNCC1N |
| InChI | InChI=1S/C16H32N4O/c1-11-13(14-5-7-18-9-15(14)17)3-4-16(19-11)21-12-6-8-20(2)10-12/h11-16,18-19H,3-10,17H2,1-2H3/t11?,12-,13?,14?,15?,16?/m0/s1 |
| InChIKey | LLFGQMBTFVDZFP-PLZWVXDASA-N |
| XLogP | 0.36 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |