C13H27N3O2 — CID 140644022
N-[2-(3-aminopiperidin-4-yl)oxyethyl]-3,3-dimethylbutanamide (PubChem CID 140644022) has the molecular formula C13H27N3O2 and a molecular weight of 257.38 g/mol. Its IUPAC name is N-[2-(3-aminopiperidin-4-yl)oxyethyl]-3,3-dimethylbutanamide.
| Compound Name | N-[2-(3-aminopiperidin-4-yl)oxyethyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 140644022 |
| Molecular Formula | C13H27N3O2 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | N-[2-(3-aminopiperidin-4-yl)oxyethyl]-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)CC(=O)NCCOC1CCNCC1N |
| InChI | InChI=1S/C13H27N3O2/c1-13(2,3)8-12(17)16-6-7-18-11-4-5-15-9-10(11)14/h10-11,15H,4-9,14H2,1-3H3,(H,16,17) |
| InChIKey | FXQXYODUANHZOA-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|