About 2,4-difluoro-5,6-bis(trifluoromethylsulfanyl)pyrimidine
2,4-difluoro-5,6-bis(trifluoromethylsulfanyl)pyrimidine (PubChem CID 14064409) has the molecular formula C6F8N2S2
and a molecular weight of 316.20 g/mol. Its IUPAC name is 2,4-difluoro-5,6-bis(trifluoromethylsulfanyl)pyrimidine.
Molecular Properties
| Compound Name | 2,4-difluoro-5,6-bis(trifluoromethylsulfanyl)pyrimidine |
| PubChem CID | 14064409 |
| Molecular Formula | C6F8N2S2 |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 315.94 |
| IUPAC Name | 2,4-difluoro-5,6-bis(trifluoromethylsulfanyl)pyrimidine |
| SMILES | Fc1nc(F)c(SC(F)(F)F)c(SC(F)(F)F)n1 |
| InChI | InChI=1S/C6F8N2S2/c7-2-1(17-5(9,10)11)3(16-4(8)15-2)18-6(12,13)14 |
| InChIKey | VTMPAPQKDYKMBK-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,4-difluoro-5,6-bis(trifluoromethylsulfanyl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-difluoro-5,6-bis(trifluoromethylsulfanyl)pyrimidine?
The IUPAC name of 2,4-difluoro-5,6-bis(trifluoromethylsulfanyl)pyrimidine (CID 14064409) is 2,4-difluoro-5,6-bis(trifluoromethylsulfanyl)pyrimidine.
What is the SMILES notation for 2,4-difluoro-5,6-bis(trifluoromethylsulfanyl)pyrimidine?
The canonical SMILES for 2,4-difluoro-5,6-bis(trifluoromethylsulfanyl)pyrimidine is Fc1nc(F)c(SC(F)(F)F)c(SC(F)(F)F)n1.
What is the InChIKey of 2,4-difluoro-5,6-bis(trifluoromethylsulfanyl)pyrimidine?
The InChIKey is VTMPAPQKDYKMBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6F8N2S2/c7-2-1(17-5(9,10)11)3(16-4(8)15-2)18-6(12,13)14.
What are the key properties of 2,4-difluoro-5,6-bis(trifluoromethylsulfanyl)pyrimidine?
2,4-difluoro-5,6-bis(trifluoromethylsulfanyl)pyrimidine has a molecular weight of 316.20 g/mol, XLogP of 3.98, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-difluoro-5,6-bis(trifluoromethylsulfanyl)pyrimidine is sourced from PubChem (CID 14064409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).