C26H19F5O6S2 — CID 140644206
[1,1,1,3,3-pentafluoro-3-(9-oxo-10-phenylthioxanthen-10-yl)oxysulfonylpropan-2-yl] 2-methylprop-2-enoate (PubChem CID 140644206) has the molecular formula C26H19F5O6S2 and a molecular weight of 586.56 g/mol. Its IUPAC name is [1,1,1,3,3-pentafluoro-3-(9-oxo-10-phenylthioxanthen-10-yl)oxysulfonylpropan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [1,1,1,3,3-pentafluoro-3-(9-oxo-10-phenylthioxanthen-10-yl)oxysulfonylpropan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 140644206 |
| Molecular Formula | C26H19F5O6S2 |
| Molecular Weight | 586.56 g/mol |
| Exact Mass | 586.05 |
| IUPAC Name | [1,1,1,3,3-pentafluoro-3-(9-oxo-10-phenylthioxanthen-10-yl)oxysulfonylpropan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C(F)(F)F)C(F)(F)S(=O)(=O)OS1(c2ccccc2)c2ccccc2C(=O)c2ccccc21 |
| InChI | InChI=1S/C26H19F5O6S2/c1-16(2)23(33)36-24(25(27,28)29)26(30,31)39(34,35)37-38(17-10-4-3-5-11-17)20-14-8-6-12-18(20)22(32)19-13-7-9-15-21(19)38/h3-15,24H,1H2,2H3 |
| InChIKey | JWLBIIFGFHLLEU-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.56 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|