C9H14S — CID 14064505
2,3,4,5-tetramethylcyclopenta-2,4-diene-1-thiol (PubChem CID 14064505) has the molecular formula C9H14S and a molecular weight of 154.28 g/mol. Its IUPAC name is 2,3,4,5-tetramethylcyclopenta-2,4-diene-1-thiol.
| Compound Name | 2,3,4,5-tetramethylcyclopenta-2,4-diene-1-thiol |
|---|---|
| PubChem CID | 14064505 |
| Molecular Formula | C9H14S |
| Molecular Weight | 154.28 g/mol |
| Exact Mass | 154.08 |
| IUPAC Name | 2,3,4,5-tetramethylcyclopenta-2,4-diene-1-thiol |
| SMILES | CC1=C(C)C(S)C(C)=C1C |
| InChI | InChI=1S/C9H14S/c1-5-6(2)8(4)9(10)7(5)3/h9-10H,1-4H3 |
| InChIKey | WNYPBTZOLXMAJA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.28 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|