C10H14NO9S2- — CID 140645606
3-amino-4-[(5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-4-oxobutane-1-sulfonate (PubChem CID 140645606) has the molecular formula C10H14NO9S2- and a molecular weight of 356.35 g/mol. Its IUPAC name is 3-amino-4-[(5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-4-oxobutane-1-sulfonate.
| Compound Name | 3-amino-4-[(5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-4-oxobutane-1-sulfonate |
|---|---|
| PubChem CID | 140645606 |
| Molecular Formula | C10H14NO9S2- |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | 3-amino-4-[(5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-4-oxobutane-1-sulfonate |
| SMILES | NC(CCS(=O)(=O)[O-])C(=O)OC1C2CC3C(O2)C1OS3(=O)=O |
| InChI | InChI=1S/C10H15NO9S2/c11-4(1-2-21(13,14)15)10(12)19-7-5-3-6-8(18-5)9(7)20-22(6,16)17/h4-9H,1-3,11H2,(H,13,14,15)/p-1 |
| InChIKey | CUOHDVLVLSEDMU-UHFFFAOYSA-M |
| XLogP | -2.57 |
| TPSA | 162.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | -2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|